About azanium;tetrabutylphosphanium;tetrafluoroborate
azanium;tetrabutylphosphanium;tetrafluoroborate (PubChem CID 175245992) has the molecular formula C16H40BF4NP+
and a molecular weight of 364.28 g/mol. Its IUPAC name is azanium;tetrabutylphosphanium;tetrafluoroborate.
Molecular Properties
| Compound Name | azanium;tetrabutylphosphanium;tetrafluoroborate |
| PubChem CID | 175245992 |
| Molecular Formula | C16H40BF4NP+ |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | azanium;tetrabutylphosphanium;tetrafluoroborate |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.F[B-](F)(F)F.[NH4+] |
| InChI | InChI=1S/C16H36P.BF4.H3N/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5;/h5-16H2,1-4H3;;1H3/q+1;-1;/p+1 |
| InChIKey | FTWILDAZKYMUKX-UHFFFAOYSA-O |
| XLogP | 7.88 |
| TPSA | 36.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azanium;tetrabutylphosphanium;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;tetrabutylphosphanium;tetrafluoroborate?
The IUPAC name of azanium;tetrabutylphosphanium;tetrafluoroborate (CID 175245992) is azanium;tetrabutylphosphanium;tetrafluoroborate.
What is the SMILES notation for azanium;tetrabutylphosphanium;tetrafluoroborate?
The canonical SMILES for azanium;tetrabutylphosphanium;tetrafluoroborate is CCCC[P+](CCCC)(CCCC)CCCC.F[B-](F)(F)F.[NH4+].
What is the InChIKey of azanium;tetrabutylphosphanium;tetrafluoroborate?
The InChIKey is FTWILDAZKYMUKX-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H36P.BF4.H3N/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)5;/h5-16H2,1-4H3;;1H3/q+1;-1;/p+1.
What are the key properties of azanium;tetrabutylphosphanium;tetrafluoroborate?
azanium;tetrabutylphosphanium;tetrafluoroborate has a molecular weight of 364.28 g/mol, XLogP of 7.88, 12 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;tetrabutylphosphanium;tetrafluoroborate is sourced from PubChem (CID 175245992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).