C16H17BrFN3O — CID 175247308
1-[5-(aminomethyl)-2-fluorophenyl]-1-(4-bromo-2-ethylphenyl)urea (PubChem CID 175247308) has the molecular formula C16H17BrFN3O and a molecular weight of 366.23 g/mol. Its IUPAC name is 1-[5-(aminomethyl)-2-fluorophenyl]-1-(4-bromo-2-ethylphenyl)urea.
| Compound Name | 1-[5-(aminomethyl)-2-fluorophenyl]-1-(4-bromo-2-ethylphenyl)urea |
|---|---|
| PubChem CID | 175247308 |
| Molecular Formula | C16H17BrFN3O |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 1-[5-(aminomethyl)-2-fluorophenyl]-1-(4-bromo-2-ethylphenyl)urea |
| SMILES | CCc1cc(Br)ccc1N(C(N)=O)c1cc(CN)ccc1F |
| InChI | InChI=1S/C16H17BrFN3O/c1-2-11-8-12(17)4-6-14(11)21(16(20)22)15-7-10(9-19)3-5-13(15)18/h3-8H,2,9,19H2,1H3,(H2,20,22) |
| InChIKey | GOZJNIQFNCWUPV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |