About 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride
1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride (PubChem CID 175251284) has the molecular formula C8H6Cl3F3O2S
and a molecular weight of 329.55 g/mol. Its IUPAC name is 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride.
Molecular Properties
| Compound Name | 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride |
| PubChem CID | 175251284 |
| Molecular Formula | C8H6Cl3F3O2S |
| Molecular Weight | 329.55 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride |
| SMILES | Cc1cccc(Cl)c1C(F)(F)F.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C8H6ClF3.Cl2O2S/c1-5-3-2-4-6(9)7(5)8(10,11)12;1-5(2,3)4/h2-4H,1H3; |
| InChIKey | ATMKPJFGKCUCGK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride?
The IUPAC name of 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride (CID 175251284) is 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride.
What is the SMILES notation for 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride?
The canonical SMILES for 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride is Cc1cccc(Cl)c1C(F)(F)F.O=S(=O)(Cl)Cl.
What is the InChIKey of 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride?
The InChIKey is ATMKPJFGKCUCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF3.Cl2O2S/c1-5-3-2-4-6(9)7(5)8(10,11)12;1-5(2,3)4/h2-4H,1H3;.
What are the key properties of 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride?
1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride has a molecular weight of 329.55 g/mol, XLogP of 4.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-methyl-2-(trifluoromethyl)benzene;sulfuryl dichloride is sourced from PubChem (CID 175251284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).