C12H24BrNO3Si — CID 175251728
trimethoxy-tris(prop-2-enyl)silylazanium bromide (PubChem CID 175251728) has the molecular formula C12H24BrNO3Si and a molecular weight of 338.32 g/mol. Its IUPAC name is trimethoxy-tris(prop-2-enyl)silylazanium bromide.
| Compound Name | trimethoxy-tris(prop-2-enyl)silylazanium bromide |
|---|---|
| PubChem CID | 175251728 |
| Molecular Formula | C12H24BrNO3Si |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | trimethoxy-tris(prop-2-enyl)silylazanium bromide |
| SMILES | C=CC[Si](CC=C)(CC=C)[N+](OC)(OC)OC.[Br-] |
| InChI | InChI=1S/C12H24NO3Si.BrH/c1-7-10-17(11-8-2,12-9-3)13(14-4,15-5)16-6;/h7-9H,1-3,10-12H2,4-6H3;1H/q+1;/p-1 |
| InChIKey | JLKCPRNGQUDHOC-UHFFFAOYSA-M |
| XLogP | -0.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|