About 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate
2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate (PubChem CID 175254582) has the molecular formula C13H11BrFNO4S2
and a molecular weight of 408.27 g/mol. Its IUPAC name is 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate.
Molecular Properties
| Compound Name | 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate |
| PubChem CID | 175254582 |
| Molecular Formula | C13H11BrFNO4S2 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate |
| SMILES | C=CS(=O)(=O)Oc1ccsc1.NC(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C7H5BrFNO.C6H6O3S2/c8-6-3-4(9)1-2-5(6)7(10)11;1-2-11(7,8)9-6-3-4-10-5-6/h1-3H,(H2,10,11);2-5H,1H2 |
| InChIKey | JBSWYZNBVCCUOC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate?
The IUPAC name of 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate (CID 175254582) is 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate.
What is the SMILES notation for 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate?
The canonical SMILES for 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate is C=CS(=O)(=O)Oc1ccsc1.NC(=O)c1ccc(F)cc1Br.
What is the InChIKey of 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate?
The InChIKey is JBSWYZNBVCCUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrFNO.C6H6O3S2/c8-6-3-4(9)1-2-5(6)7(10)11;1-2-11(7,8)9-6-3-4-10-5-6/h1-3H,(H2,10,11);2-5H,1H2.
What are the key properties of 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate?
2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate has a molecular weight of 408.27 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-fluorobenzamide;thiophen-3-yl ethenesulfonate is sourced from PubChem (CID 175254582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).