C17H26O5 — CID 175254611
(2S)-5-[3-[(2S)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypentanoic acid (PubChem CID 175254611) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (2S)-5-[3-[(2S)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypentanoic acid.
| Compound Name | (2S)-5-[3-[(2S)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypentanoic acid |
|---|---|
| PubChem CID | 175254611 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (2S)-5-[3-[(2S)-2-hydroxypropoxy]phenyl]-2-propan-2-yloxypentanoic acid |
| SMILES | CC(C)O[C@@H](CCCc1cccc(OC[C@H](C)O)c1)C(=O)O |
| InChI | InChI=1S/C17H26O5/c1-12(2)22-16(17(19)20)9-5-7-14-6-4-8-15(10-14)21-11-13(3)18/h4,6,8,10,12-13,16,18H,5,7,9,11H2,1-3H3,(H,19,20)/t13-,16-/m0/s1 |
| InChIKey | QWHKUBZKPMYQOE-BBRMVZONSA-N |
| XLogP | 2.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |