C19H18BrNO6S — CID 175256538
2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-4-(methanesulfonamidomethyl)phenyl]acetic acid (PubChem CID 175256538) has the molecular formula C19H18BrNO6S and a molecular weight of 468.33 g/mol. Its IUPAC name is 2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-4-(methanesulfonamidomethyl)phenyl]acetic acid.
| Compound Name | 2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-4-(methanesulfonamidomethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 175256538 |
| Molecular Formula | C19H18BrNO6S |
| Molecular Weight | 468.33 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-[2-[(7-bromo-1-benzofuran-5-yl)methoxy]-4-(methanesulfonamidomethyl)phenyl]acetic acid |
| SMILES | CS(=O)(=O)NCc1ccc(CC(=O)O)c(OCc2cc(Br)c3occc3c2)c1 |
| InChI | InChI=1S/C19H18BrNO6S/c1-28(24,25)21-10-12-2-3-14(9-18(22)23)17(8-12)27-11-13-6-15-4-5-26-19(15)16(20)7-13/h2-8,21H,9-11H2,1H3,(H,22,23) |
| InChIKey | FEIVDVPKMAIGFA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |