C30H33F4N3O3S — CID 175257459
1-[2-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-5-(trifluoromethyl)phenyl]-4-benzylpiperidine (PubChem CID 175257459) has the molecular formula C30H33F4N3O3S and a molecular weight of 591.67 g/mol. Its IUPAC name is 1-[2-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-5-(trifluoromethyl)phenyl]-4-benzylpiperidine.
| Compound Name | 1-[2-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-5-(trifluoromethyl)phenyl]-4-benzylpiperidine |
|---|---|
| PubChem CID | 175257459 |
| Molecular Formula | C30H33F4N3O3S |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 1-[2-[4-amino-3-[3-fluoro-4-[methyl(sulfino)amino]phenyl]-4-oxobutyl]-5-(trifluoromethyl)phenyl]-4-benzylpiperidine |
| SMILES | CN(c1ccc(C(CCc2ccc(C(F)(F)F)cc2N2CCC(Cc3ccccc3)CC2)C(N)=O)cc1F)S(=O)O |
| InChI | InChI=1S/C30H33F4N3O3S/c1-36(41(39)40)27-12-9-23(18-26(27)31)25(29(35)38)11-8-22-7-10-24(30(32,33)34)19-28(22)37-15-13-21(14-16-37)17-20-5-3-2-4-6-20/h2-7,9-10,12,18-19,21,25H,8,11,13-17H2,1H3,(H2,35,38)(H,39,40) |
| InChIKey | VWFWCRULXGMAFI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|