C20H29N3O2 — CID 175261649
tert-butyl (2R)-2-[ethyl(1H-indol-3-yl)amino]piperidine-1-carboxylate (PubChem CID 175261649) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is tert-butyl (2R)-2-[ethyl(1H-indol-3-yl)amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[ethyl(1H-indol-3-yl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175261649 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | tert-butyl (2R)-2-[ethyl(1H-indol-3-yl)amino]piperidine-1-carboxylate |
| SMILES | CCN(c1c[nH]c2ccccc12)[C@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H29N3O2/c1-5-22(17-14-21-16-11-7-6-10-15(16)17)18-12-8-9-13-23(18)19(24)25-20(2,3)4/h6-7,10-11,14,18,21H,5,8-9,12-13H2,1-4H3/t18-/m1/s1 |
| InChIKey | SIOVTGQKLVCSRE-GOSISDBHSA-N |
| XLogP | 4.74 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |