C15H24N2O3 — CID 160564049
tert-butyl 2-(1H-pyrrol-2-ylmethoxy)piperidine-1-carboxylate (PubChem CID 160564049) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl 2-(1H-pyrrol-2-ylmethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(1H-pyrrol-2-ylmethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160564049 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | tert-butyl 2-(1H-pyrrol-2-ylmethoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1OCc1ccc[nH]1 |
| InChI | InChI=1S/C15H24N2O3/c1-15(2,3)20-14(18)17-10-5-4-8-13(17)19-11-12-7-6-9-16-12/h6-7,9,13,16H,4-5,8,10-11H2,1-3H3 |
| InChIKey | QZRPHYAINXIRCZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |