C13H18N4O2 — CID 175262489
[2-(4-cyclopropylpiperazin-1-yl)pyrimidin-5-yl] acetate (PubChem CID 175262489) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is [2-(4-cyclopropylpiperazin-1-yl)pyrimidin-5-yl] acetate.
| Compound Name | [2-(4-cyclopropylpiperazin-1-yl)pyrimidin-5-yl] acetate |
|---|---|
| PubChem CID | 175262489 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [2-(4-cyclopropylpiperazin-1-yl)pyrimidin-5-yl] acetate |
| SMILES | CC(=O)Oc1cnc(N2CCN(C3CC3)CC2)nc1 |
| InChI | InChI=1S/C13H18N4O2/c1-10(18)19-12-8-14-13(15-9-12)17-6-4-16(5-7-17)11-2-3-11/h8-9,11H,2-7H2,1H3 |
| InChIKey | YCZAFLVNNJTZGH-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |