C6H14N2O2 — CID 175262598
(2S,3R)-4-amino-2-(aminomethyl)-3-methylbutanoic acid (PubChem CID 175262598) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (2S,3R)-4-amino-2-(aminomethyl)-3-methylbutanoic acid.
| Compound Name | (2S,3R)-4-amino-2-(aminomethyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 175262598 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (2S,3R)-4-amino-2-(aminomethyl)-3-methylbutanoic acid |
| SMILES | C[C@@H](CN)C(CN)C(=O)O |
| InChI | InChI=1S/C6H14N2O2/c1-4(2-7)5(3-8)6(9)10/h4-5H,2-3,7-8H2,1H3,(H,9,10)/t4-,5?/m0/s1 |
| InChIKey | YPEXLZVHIICQKL-ROLXFIACSA-N |
| XLogP | -0.76 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |