C26H25FN4O4S — CID 175263246
(E)-3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-[1-(2-hydroxy-4-methylphenyl)prop-2-enylsulfonyl]prop-2-enamide (PubChem CID 175263246) has the molecular formula C26H25FN4O4S and a molecular weight of 508.58 g/mol. Its IUPAC name is (E)-3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-[1-(2-hydroxy-4-methylphenyl)prop-2-enylsulfonyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-[1-(2-hydroxy-4-methylphenyl)prop-2-enylsulfonyl]prop-2-enamide |
|---|---|
| PubChem CID | 175263246 |
| Molecular Formula | C26H25FN4O4S |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | (E)-3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-[1-(2-hydroxy-4-methylphenyl)prop-2-enylsulfonyl]prop-2-enamide |
| SMILES | C=CC(c1ccc(C)cc1O)S(=O)(=O)NC(=O)/C=C/c1c(C)nn(C)c1-n1ccc2cc(F)ccc21 |
| InChI | InChI=1S/C26H25FN4O4S/c1-5-24(21-8-6-16(2)14-23(21)32)36(34,35)29-25(33)11-9-20-17(3)28-30(4)26(20)31-13-12-18-15-19(27)7-10-22(18)31/h5-15,24,32H,1H2,2-4H3,(H,29,33)/b11-9+ |
| InChIKey | PVQKSXSDNZLCKJ-PKNBQFBNSA-N |
| XLogP | 4.21 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|