C23H21FN4O4S — CID 66858665
3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-(2-hydroxy-4-methylphenyl)sulfonylprop-2-enamide (PubChem CID 66858665) has the molecular formula C23H21FN4O4S and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-(2-hydroxy-4-methylphenyl)sulfonylprop-2-enamide.
| Compound Name | 3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-(2-hydroxy-4-methylphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 66858665 |
| Molecular Formula | C23H21FN4O4S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 3-[5-(5-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-(2-hydroxy-4-methylphenyl)sulfonylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C=Cc2c(C)nn(C)c2-n2ccc3cc(F)ccc32)c(O)c1 |
| InChI | InChI=1S/C23H21FN4O4S/c1-14-4-8-21(20(29)12-14)33(31,32)26-22(30)9-6-18-15(2)25-27(3)23(18)28-11-10-16-13-17(24)5-7-19(16)28/h4-13,29H,1-3H3,(H,26,30) |
| InChIKey | BJKYELAKOMWKOB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|