C16H28F2N2O4 — CID 175263316
tert-butyl formate;(4,4-difluoropiperidin-1-yl)-(2,2-dimethyl-1,3-oxazolidin-4-yl)methanone (PubChem CID 175263316) has the molecular formula C16H28F2N2O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is tert-butyl formate;(4,4-difluoropiperidin-1-yl)-(2,2-dimethyl-1,3-oxazolidin-4-yl)methanone.
| Compound Name | tert-butyl formate;(4,4-difluoropiperidin-1-yl)-(2,2-dimethyl-1,3-oxazolidin-4-yl)methanone |
|---|---|
| PubChem CID | 175263316 |
| Molecular Formula | C16H28F2N2O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl formate;(4,4-difluoropiperidin-1-yl)-(2,2-dimethyl-1,3-oxazolidin-4-yl)methanone |
| SMILES | CC(C)(C)OC=O.CC1(C)NC(C(=O)N2CCC(F)(F)CC2)CO1 |
| InChI | InChI=1S/C11H18F2N2O2.C5H10O2/c1-10(2)14-8(7-17-10)9(16)15-5-3-11(12,13)4-6-15;1-5(2,3)7-4-6/h8,14H,3-7H2,1-2H3;4H,1-3H3 |
| InChIKey | MHNJNBLLMBNMNY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|