About ethyl 4-oxobutanoate;2-methylprop-2-enoic acid
ethyl 4-oxobutanoate;2-methylprop-2-enoic acid (PubChem CID 175264095) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is ethyl 4-oxobutanoate;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | ethyl 4-oxobutanoate;2-methylprop-2-enoic acid |
| PubChem CID | 175264095 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | ethyl 4-oxobutanoate;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCOC(=O)CCC=O |
| InChI | InChI=1S/C6H10O3.C4H6O2/c1-2-9-6(8)4-3-5-7;1-3(2)4(5)6/h5H,2-4H2,1H3;1H2,2H3,(H,5,6) |
| InChIKey | ONHQHKBDCHBKEM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-oxobutanoate;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxobutanoate;2-methylprop-2-enoic acid?
The IUPAC name of ethyl 4-oxobutanoate;2-methylprop-2-enoic acid (CID 175264095) is ethyl 4-oxobutanoate;2-methylprop-2-enoic acid.
What is the SMILES notation for ethyl 4-oxobutanoate;2-methylprop-2-enoic acid?
The canonical SMILES for ethyl 4-oxobutanoate;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCOC(=O)CCC=O.
What is the InChIKey of ethyl 4-oxobutanoate;2-methylprop-2-enoic acid?
The InChIKey is ONHQHKBDCHBKEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C4H6O2/c1-2-9-6(8)4-3-5-7;1-3(2)4(5)6/h5H,2-4H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of ethyl 4-oxobutanoate;2-methylprop-2-enoic acid?
ethyl 4-oxobutanoate;2-methylprop-2-enoic acid has a molecular weight of 216.23 g/mol, XLogP of 1.18, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxobutanoate;2-methylprop-2-enoic acid is sourced from PubChem (CID 175264095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).