About ethyl butanoate;hexanal
ethyl butanoate;hexanal (PubChem CID 88606790) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is ethyl butanoate;hexanal.
Molecular Properties
| Compound Name | ethyl butanoate;hexanal |
| PubChem CID | 88606790 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | ethyl butanoate;hexanal |
| SMILES | CCCC(=O)OCC.CCCCCC=O |
| InChI | InChI=1S/C6H12O2.C6H12O/c1-3-5-6(7)8-4-2;1-2-3-4-5-6-7/h3-5H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | WDQJCPCIOWZEST-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl butanoate;hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl butanoate;hexanal?
The IUPAC name of ethyl butanoate;hexanal (CID 88606790) is ethyl butanoate;hexanal.
What is the SMILES notation for ethyl butanoate;hexanal?
The canonical SMILES for ethyl butanoate;hexanal is CCCC(=O)OCC.CCCCCC=O.
What is the InChIKey of ethyl butanoate;hexanal?
The InChIKey is WDQJCPCIOWZEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C6H12O/c1-3-5-6(7)8-4-2;1-2-3-4-5-6-7/h3-5H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of ethyl butanoate;hexanal?
ethyl butanoate;hexanal has a molecular weight of 216.32 g/mol, XLogP of 3.12, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl butanoate;hexanal is sourced from PubChem (CID 88606790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).