C9H13FN2OS — CID 175265109
[2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 175265109) has the molecular formula C9H13FN2OS and a molecular weight of 216.28 g/mol. Its IUPAC name is [2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 175265109 |
| Molecular Formula | C9H13FN2OS |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | [2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1cnc(C2(F)CCNCC2)s1 |
| InChI | InChI=1S/C9H13FN2OS/c10-9(1-3-11-4-2-9)8-12-5-7(6-13)14-8/h5,11,13H,1-4,6H2 |
| InChIKey | IGFVYAYTRLLZMT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |