C10H15NOS — CID 64981659
(2-cyclohexyl-1,3-thiazol-5-yl)methanol (PubChem CID 64981659) has the molecular formula C10H15NOS and a molecular weight of 197.30 g/mol. Its IUPAC name is (2-cyclohexyl-1,3-thiazol-5-yl)methanol.
| Compound Name | (2-cyclohexyl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 64981659 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2-cyclohexyl-1,3-thiazol-5-yl)methanol |
| SMILES | OCc1cnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C10H15NOS/c12-7-9-6-11-10(13-9)8-4-2-1-3-5-8/h6,8,12H,1-5,7H2 |
| InChIKey | JYRWTARSMHOZJR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |