C8H13NOS — CID 21085977
[2-(2-methylpropyl)-1,3-thiazol-5-yl]methanol (PubChem CID 21085977) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 21085977 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | [2-(2-methylpropyl)-1,3-thiazol-5-yl]methanol |
| SMILES | CC(C)Cc1ncc(CO)s1 |
| InChI | InChI=1S/C8H13NOS/c1-6(2)3-8-9-4-7(5-10)11-8/h4,6,10H,3,5H2,1-2H3 |
| InChIKey | WFDMPHVGYRVFMV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |