C10H17NOS — CID 21408259
(2-hexyl-1,3-thiazol-5-yl)methanol (PubChem CID 21408259) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is (2-hexyl-1,3-thiazol-5-yl)methanol.
| Compound Name | (2-hexyl-1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 21408259 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (2-hexyl-1,3-thiazol-5-yl)methanol |
| SMILES | CCCCCCc1ncc(CO)s1 |
| InChI | InChI=1S/C10H17NOS/c1-2-3-4-5-6-10-11-7-9(8-12)13-10/h7,12H,2-6,8H2,1H3 |
| InChIKey | UDWMYKPRXQWQQK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|