C35H35N7O2 — CID 175266073
N-[1-[(1R)-2-(1H-indol-3-yl)-1-[5-[2-(1H-indol-3-yl)ethyl]-4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl]-2,5-dihydropyrrol-2-yl]formamide (PubChem CID 175266073) has the molecular formula C35H35N7O2 and a molecular weight of 585.71 g/mol. Its IUPAC name is N-[1-[(1R)-2-(1H-indol-3-yl)-1-[5-[2-(1H-indol-3-yl)ethyl]-4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl]-2,5-dihydropyrrol-2-yl]formamide.
| Compound Name | N-[1-[(1R)-2-(1H-indol-3-yl)-1-[5-[2-(1H-indol-3-yl)ethyl]-4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl]-2,5-dihydropyrrol-2-yl]formamide |
|---|---|
| PubChem CID | 175266073 |
| Molecular Formula | C35H35N7O2 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | N-[1-[(1R)-2-(1H-indol-3-yl)-1-[5-[2-(1H-indol-3-yl)ethyl]-4-[(4-methoxyphenyl)methyl]-1,2,4-triazol-3-yl]ethyl]-2,5-dihydropyrrol-2-yl]formamide |
| SMILES | COc1ccc(Cn2c(CCc3c[nH]c4ccccc34)nnc2[C@@H](Cc2c[nH]c3ccccc23)N2CC=CC2NC=O)cc1 |
| InChI | InChI=1S/C35H35N7O2/c1-44-27-15-12-24(13-16-27)22-42-34(17-14-25-20-36-30-9-4-2-7-28(25)30)39-40-35(42)32(41-18-6-11-33(41)38-23-43)19-26-21-37-31-10-5-3-8-29(26)31/h2-13,15-16,20-21,23,32-33,36-37H,14,17-19,22H2,1H3,(H,38,43)/t32-,33?/m1/s1 |
| InChIKey | IKLJCRGNHKMOAZ-KWRHIPAJSA-N |
| XLogP | 5.31 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|