C30H28N6O — CID 89007667
N-[(1R)-1-[4-benzyl-5-[2-(1H-indol-3-yl)ethyl]-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide (PubChem CID 89007667) has the molecular formula C30H28N6O and a molecular weight of 488.60 g/mol. Its IUPAC name is N-[(1R)-1-[4-benzyl-5-[2-(1H-indol-3-yl)ethyl]-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide.
| Compound Name | N-[(1R)-1-[4-benzyl-5-[2-(1H-indol-3-yl)ethyl]-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide |
|---|---|
| PubChem CID | 89007667 |
| Molecular Formula | C30H28N6O |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | N-[(1R)-1-[4-benzyl-5-[2-(1H-indol-3-yl)ethyl]-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide |
| SMILES | O=CN[C@H](Cc1c[nH]c2ccccc12)c1nnc(CCc2c[nH]c3ccccc23)n1Cc1ccccc1 |
| InChI | InChI=1S/C30H28N6O/c37-20-33-28(16-23-18-32-27-13-7-5-11-25(23)27)30-35-34-29(36(30)19-21-8-2-1-3-9-21)15-14-22-17-31-26-12-6-4-10-24(22)26/h1-13,17-18,20,28,31-32H,14-16,19H2,(H,33,37)/t28-/m1/s1 |
| InChIKey | VFBQHOBLBKHZOW-MUUNZHRXSA-N |
| XLogP | 5.10 |
| TPSA | 91.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|