C30H31N5O — CID 89007657
N-[(1R)-1-[4-[(4-ethylphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide (PubChem CID 89007657) has the molecular formula C30H31N5O and a molecular weight of 477.61 g/mol. Its IUPAC name is N-[(1R)-1-[4-[(4-ethylphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide.
| Compound Name | N-[(1R)-1-[4-[(4-ethylphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide |
|---|---|
| PubChem CID | 89007657 |
| Molecular Formula | C30H31N5O |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | N-[(1R)-1-[4-[(4-ethylphenyl)methyl]-5-(2-phenylethyl)-1,2,4-triazol-3-yl]-2-(1H-indol-3-yl)ethyl]formamide |
| SMILES | CCc1ccc(Cn2c(CCc3ccccc3)nnc2[C@@H](Cc2c[nH]c3ccccc23)NC=O)cc1 |
| InChI | InChI=1S/C30H31N5O/c1-2-22-12-14-24(15-13-22)20-35-29(17-16-23-8-4-3-5-9-23)33-34-30(35)28(32-21-36)18-25-19-31-27-11-7-6-10-26(25)27/h3-15,19,21,28,31H,2,16-18,20H2,1H3,(H,32,36)/t28-/m1/s1 |
| InChIKey | VUYJKUQYOWBTAQ-MUUNZHRXSA-N |
| XLogP | 5.19 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|