About CID 175266137
CID 175266137 (PubChem CID 175266137) has the molecular formula C6H8N3Sn
and a molecular weight of 240.86 g/mol.
Molecular Properties
| Compound Name | CID 175266137 |
| PubChem CID | 175266137 |
| Molecular Formula | C6H8N3Sn |
| Molecular Weight | 240.86 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | — |
| SMILES | CN(C)c1nccc([Sn])n1 |
| InChI | InChI=1S/C6H8N3.Sn/c1-9(2)6-7-4-3-5-8-6;/h3-4H,1-2H3; |
| InChIKey | TZOJUMKIIJBCND-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.86 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 175266137 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175266137?
The IUPAC name of CID 175266137 (CID 175266137) is not available.
What is the SMILES notation for CID 175266137?
The canonical SMILES for CID 175266137 is CN(C)c1nccc([Sn])n1.
What is the InChIKey of CID 175266137?
The InChIKey is TZOJUMKIIJBCND-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N3.Sn/c1-9(2)6-7-4-3-5-8-6;/h3-4H,1-2H3;.
What are the key properties of CID 175266137?
CID 175266137 has a molecular weight of 240.86 g/mol, XLogP of -0.66, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175266137 is sourced from PubChem (CID 175266137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).