C20H25NO4 — CID 175268419
2-acetamido-3-(4-hydroxyphenyl)propanoic acid;ethene;5-methylidenecyclohexa-1,3-diene (PubChem CID 175268419) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-acetamido-3-(4-hydroxyphenyl)propanoic acid;ethene;5-methylidenecyclohexa-1,3-diene.
| Compound Name | 2-acetamido-3-(4-hydroxyphenyl)propanoic acid;ethene;5-methylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 175268419 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-acetamido-3-(4-hydroxyphenyl)propanoic acid;ethene;5-methylidenecyclohexa-1,3-diene |
| SMILES | C=C.C=C1C=CC=CC1.CC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C11H13NO4.C7H8.C2H4/c1-7(13)12-10(11(15)16)6-8-2-4-9(14)5-3-8;1-7-5-3-2-4-6-7;1-2/h2-5,10,14H,6H2,1H3,(H,12,13)(H,15,16);2-5H,1,6H2;1-2H2 |
| InChIKey | CXBPAKJGXGRPAE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|