C19H26N4O3 — CID 175270829
methyl 2-imino-4-methyl-4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate (PubChem CID 175270829) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is methyl 2-imino-4-methyl-4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate.
| Compound Name | methyl 2-imino-4-methyl-4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 175270829 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | methyl 2-imino-4-methyl-4-[4-(2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate |
| SMILES | [H]/N=C(/CC(C)(C)N1CCC(n2c(=O)[nH]c3ccccc32)CC1)C(=O)OC |
| InChI | InChI=1S/C19H26N4O3/c1-19(2,12-14(20)17(24)26-3)22-10-8-13(9-11-22)23-16-7-5-4-6-15(16)21-18(23)25/h4-7,13,20H,8-12H2,1-3H3,(H,21,25)/b20-14- |
| InChIKey | BSFXHLOYAGMTRV-ZHZULCJRSA-N |
| XLogP | 2.33 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|