C23H34N4O3 — CID 175272601
tert-butyl 2-imino-4-methyl-4-[4-(5-methyl-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate (PubChem CID 175272601) has the molecular formula C23H34N4O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is tert-butyl 2-imino-4-methyl-4-[4-(5-methyl-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate.
| Compound Name | tert-butyl 2-imino-4-methyl-4-[4-(5-methyl-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 175272601 |
| Molecular Formula | C23H34N4O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | tert-butyl 2-imino-4-methyl-4-[4-(5-methyl-2-oxo-3H-benzimidazol-1-yl)piperidin-1-yl]pentanoate |
| SMILES | [H]/N=C(/CC(C)(C)N1CCC(n2c(=O)[nH]c3cc(C)ccc32)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34N4O3/c1-15-7-8-19-18(13-15)25-21(29)27(19)16-9-11-26(12-10-16)23(5,6)14-17(24)20(28)30-22(2,3)4/h7-8,13,16,24H,9-12,14H2,1-6H3,(H,25,29)/b24-17- |
| InChIKey | BCRNRQRBIMNJBE-ULJHMMPZSA-N |
| XLogP | 3.81 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|