About 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene
2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene (PubChem CID 175271323) has the molecular formula C17H14O5S
and a molecular weight of 330.36 g/mol. Its IUPAC name is 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene.
Molecular Properties
| Compound Name | 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene |
| PubChem CID | 175271323 |
| Molecular Formula | C17H14O5S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene |
| SMILES | O=C(O)C(O)C(=O)Oc1cccc2ccccc12.c1ccsc1 |
| InChI | InChI=1S/C13H10O5.C4H4S/c14-11(12(15)16)13(17)18-10-7-3-5-8-4-1-2-6-9(8)10;1-2-4-5-3-1/h1-7,11,14H,(H,15,16);1-4H |
| InChIKey | OLYMEGFISPOJGM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene?
The IUPAC name of 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene (CID 175271323) is 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene.
What is the SMILES notation for 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene?
The canonical SMILES for 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene is O=C(O)C(O)C(=O)Oc1cccc2ccccc12.c1ccsc1.
What is the InChIKey of 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene?
The InChIKey is OLYMEGFISPOJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O5.C4H4S/c14-11(12(15)16)13(17)18-10-7-3-5-8-4-1-2-6-9(8)10;1-2-4-5-3-1/h1-7,11,14H,(H,15,16);1-4H.
What are the key properties of 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene?
2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene has a molecular weight of 330.36 g/mol, XLogP of 2.94, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-naphthalen-1-yloxy-3-oxopropanoic acid;thiophene is sourced from PubChem (CID 175271323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).