C27H32N2O7 — CID 175271900
tert-butyl 2-[4-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitrobenzoyl]prop-2-enoate (PubChem CID 175271900) has the molecular formula C27H32N2O7 and a molecular weight of 496.56 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitrobenzoyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[4-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitrobenzoyl]prop-2-enoate |
|---|---|
| PubChem CID | 175271900 |
| Molecular Formula | C27H32N2O7 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | tert-butyl 2-[4-[3-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitrobenzoyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(C)C)C(=O)c1ccc(-c2cccc(N(CC)C(=O)OC(C)(C)C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H32N2O7/c1-9-28(25(32)36-27(6,7)8)20-12-10-11-18(15-20)19-13-14-21(22(16-19)29(33)34)23(30)17(2)24(31)35-26(3,4)5/h10-16H,2,9H2,1,3-8H3 |
| InChIKey | FTMLXJVCAUFWLK-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|