C15H29ClO4 — CID 175273483
3,4,5-trihydroxy-3-pentyldecanoyl chloride (PubChem CID 175273483) has the molecular formula C15H29ClO4 and a molecular weight of 308.85 g/mol. Its IUPAC name is 3,4,5-trihydroxy-3-pentyldecanoyl chloride.
| Compound Name | 3,4,5-trihydroxy-3-pentyldecanoyl chloride |
|---|---|
| PubChem CID | 175273483 |
| Molecular Formula | C15H29ClO4 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3,4,5-trihydroxy-3-pentyldecanoyl chloride |
| SMILES | CCCCCC(O)C(O)C(O)(CCCCC)CC(=O)Cl |
| InChI | InChI=1S/C15H29ClO4/c1-3-5-7-9-12(17)14(19)15(20,11-13(16)18)10-8-6-4-2/h12,14,17,19-20H,3-11H2,1-2H3 |
| InChIKey | DHAAWQJRRZXJPB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|