C5H11NaOS — CID 175274491
sodium;hydride;4-methylsulfanylbutan-2-one (PubChem CID 175274491) has the molecular formula C5H11NaOS and a molecular weight of 142.20 g/mol. Its IUPAC name is sodium;hydride;4-methylsulfanylbutan-2-one.
| Compound Name | sodium;hydride;4-methylsulfanylbutan-2-one |
|---|---|
| PubChem CID | 175274491 |
| Molecular Formula | C5H11NaOS |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | sodium;hydride;4-methylsulfanylbutan-2-one |
| SMILES | CSCCC(C)=O.[H-].[Na+] |
| InChI | InChI=1S/C5H10OS.Na.H/c1-5(6)3-4-7-2;;/h3-4H2,1-2H3;;/q;+1;-1 |
| InChIKey | GZZJGMROIHGJSK-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |