C17H32N2O3S — CID 175275478
N,N-dibutylbutan-1-amine;pyridine-3-sulfonic acid (PubChem CID 175275478) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;pyridine-3-sulfonic acid.
| Compound Name | N,N-dibutylbutan-1-amine;pyridine-3-sulfonic acid |
|---|---|
| PubChem CID | 175275478 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N,N-dibutylbutan-1-amine;pyridine-3-sulfonic acid |
| SMILES | CCCCN(CCCC)CCCC.O=S(=O)(O)c1cccnc1 |
| InChI | InChI=1S/C12H27N.C5H5NO3S/c1-4-7-10-13(11-8-5-2)12-9-6-3;7-10(8,9)5-2-1-3-6-4-5/h4-12H2,1-3H3;1-4H,(H,7,8,9) |
| InChIKey | UPQOTCPJNOPMMH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|