About 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid
2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid (PubChem CID 71655953) has the molecular formula C19H35NO4S
and a molecular weight of 373.56 g/mol. Its IUPAC name is 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid |
| PubChem CID | 71655953 |
| Molecular Formula | C19H35NO4S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid |
| SMILES | CC(C)c1cccc(S(=O)(=O)O)c1.CCCCN(CCO)CCCC |
| InChI | InChI=1S/C10H23NO.C9H12O3S/c1-3-5-7-11(9-10-12)8-6-4-2;1-7(2)8-4-3-5-9(6-8)13(10,11)12/h12H,3-10H2,1-2H3;3-7H,1-2H3,(H,10,11,12) |
| InChIKey | CDXYBXOUPXDSPI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid?
The IUPAC name of 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid (CID 71655953) is 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid.
What is the SMILES notation for 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid?
The canonical SMILES for 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid is CC(C)c1cccc(S(=O)(=O)O)c1.CCCCN(CCO)CCCC.
What is the InChIKey of 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid?
The InChIKey is CDXYBXOUPXDSPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO.C9H12O3S/c1-3-5-7-11(9-10-12)8-6-4-2;1-7(2)8-4-3-5-9(6-8)13(10,11)12/h12H,3-10H2,1-2H3;3-7H,1-2H3,(H,10,11,12).
What are the key properties of 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid?
2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid has a molecular weight of 373.56 g/mol, XLogP of 3.94, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)ethanol;3-propan-2-ylbenzenesulfonic acid is sourced from PubChem (CID 71655953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).