C16H14S — CID 175275866
1-ethyl-2-ethynylbenzene;7-thiabicyclo[2.2.1]hepta-1,3,5-triene (PubChem CID 175275866) has the molecular formula C16H14S and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-ethyl-2-ethynylbenzene;7-thiabicyclo[2.2.1]hepta-1,3,5-triene.
| Compound Name | 1-ethyl-2-ethynylbenzene;7-thiabicyclo[2.2.1]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 175275866 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-ethyl-2-ethynylbenzene;7-thiabicyclo[2.2.1]hepta-1,3,5-triene |
| SMILES | C#Cc1ccccc1CC.c1cc2ccc1s2 |
| InChI | InChI=1S/C10H10.C6H4S/c1-3-9-7-5-6-8-10(9)4-2;1-2-6-4-3-5(1)7-6/h1,5-8H,4H2,2H3;1-4H |
| InChIKey | OWAGEOGGVLNYRF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|