C13H28O3 — CID 175276531
3-methylbutan-2-yloxycyclopentane;propane-1,2-diol (PubChem CID 175276531) has the molecular formula C13H28O3 and a molecular weight of 232.36 g/mol. Its IUPAC name is 3-methylbutan-2-yloxycyclopentane;propane-1,2-diol.
| Compound Name | 3-methylbutan-2-yloxycyclopentane;propane-1,2-diol |
|---|---|
| PubChem CID | 175276531 |
| Molecular Formula | C13H28O3 |
| Molecular Weight | 232.36 g/mol |
| Exact Mass | 232.20 |
| IUPAC Name | 3-methylbutan-2-yloxycyclopentane;propane-1,2-diol |
| SMILES | CC(C)C(C)OC1CCCC1.CC(O)CO |
| InChI | InChI=1S/C10H20O.C3H8O2/c1-8(2)9(3)11-10-6-4-5-7-10;1-3(5)2-4/h8-10H,4-7H2,1-3H3;3-5H,2H2,1H3 |
| InChIKey | ZCHMLTUSSOYNQE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |