C18H27IN4O3 — CID 175278963
[4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]-4-isocyanatopiperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 175278963) has the molecular formula C18H27IN4O3 and a molecular weight of 474.34 g/mol. Its IUPAC name is [4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]-4-isocyanatopiperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]-4-isocyanatopiperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175278963 |
| Molecular Formula | C18H27IN4O3 |
| Molecular Weight | 474.34 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | [4-[(3-iodo-1-propan-2-ylpyrazol-4-yl)methyl]-4-isocyanatopiperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)n1cc(CC2(N=C=O)CCN(OC(=O)C(C)(C)C)CC2)c(I)n1 |
| InChI | InChI=1S/C18H27IN4O3/c1-13(2)23-11-14(15(19)21-23)10-18(20-12-24)6-8-22(9-7-18)26-16(25)17(3,4)5/h11,13H,6-10H2,1-5H3 |
| InChIKey | NCASVHCEMQZCCE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|