C23H25F6N3O5S — CID 175280304
2-(2-aminophenyl)-3-oxo-3-[[6-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]oxy-3-pyridinyl]methylamino]propane-1-sulfonic acid (PubChem CID 175280304) has the molecular formula C23H25F6N3O5S and a molecular weight of 569.52 g/mol. Its IUPAC name is 2-(2-aminophenyl)-3-oxo-3-[[6-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]oxy-3-pyridinyl]methylamino]propane-1-sulfonic acid.
| Compound Name | 2-(2-aminophenyl)-3-oxo-3-[[6-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]oxy-3-pyridinyl]methylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175280304 |
| Molecular Formula | C23H25F6N3O5S |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 2-(2-aminophenyl)-3-oxo-3-[[6-(trifluoromethyl)-2-[4-(trifluoromethyl)cyclohexyl]oxy-3-pyridinyl]methylamino]propane-1-sulfonic acid |
| SMILES | Nc1ccccc1C(CS(=O)(=O)O)C(=O)NCc1ccc(C(F)(F)F)nc1OC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H25F6N3O5S/c24-22(25,26)14-6-8-15(9-7-14)37-21-13(5-10-19(32-21)23(27,28)29)11-31-20(33)17(12-38(34,35)36)16-3-1-2-4-18(16)30/h1-5,10,14-15,17H,6-9,11-12,30H2,(H,31,33)(H,34,35,36) |
| InChIKey | DMGDBODHVNUEGZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 131.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|