C25H22F6N2O5S — CID 175281867
2-(2-aminophenyl)-3-oxo-3-[[4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]propane-1-sulfonic acid (PubChem CID 175281867) has the molecular formula C25H22F6N2O5S and a molecular weight of 576.52 g/mol. Its IUPAC name is 2-(2-aminophenyl)-3-oxo-3-[[4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]propane-1-sulfonic acid.
| Compound Name | 2-(2-aminophenyl)-3-oxo-3-[[4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175281867 |
| Molecular Formula | C25H22F6N2O5S |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 2-(2-aminophenyl)-3-oxo-3-[[4-(trifluoromethyl)-2-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]methylamino]propane-1-sulfonic acid |
| SMILES | Nc1ccccc1C(CS(=O)(=O)O)C(=O)NCc1ccc(C(F)(F)F)cc1OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H22F6N2O5S/c26-24(27,28)17-8-5-15(6-9-17)13-38-22-11-18(25(29,30)31)10-7-16(22)12-33-23(34)20(14-39(35,36)37)19-3-1-2-4-21(19)32/h1-11,20H,12-14,32H2,(H,33,34)(H,35,36,37) |
| InChIKey | JDPVRCMWDOHBCZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|