C13H15N3OS — CID 175281556
2-(4-morpholin-2-ylphenyl)-1,3-thiazol-5-amine (PubChem CID 175281556) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 2-(4-morpholin-2-ylphenyl)-1,3-thiazol-5-amine.
| Compound Name | 2-(4-morpholin-2-ylphenyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 175281556 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 2-(4-morpholin-2-ylphenyl)-1,3-thiazol-5-amine |
| SMILES | Nc1cnc(-c2ccc(C3CNCCO3)cc2)s1 |
| InChI | InChI=1S/C13H15N3OS/c14-12-8-16-13(18-12)10-3-1-9(2-4-10)11-7-15-5-6-17-11/h1-4,8,11,15H,5-7,14H2 |
| InChIKey | UPGXFZVJDPDVEZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |