C29H33ClN4O6 — CID 175282090
[2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-6-nitrophenyl] 4,4-dimethylpentanoate (PubChem CID 175282090) has the molecular formula C29H33ClN4O6 and a molecular weight of 569.06 g/mol. Its IUPAC name is [2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-6-nitrophenyl] 4,4-dimethylpentanoate.
| Compound Name | [2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-6-nitrophenyl] 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 175282090 |
| Molecular Formula | C29H33ClN4O6 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | [2-[4-[2-[bis(prop-2-enyl)amino]-5-chlorophenyl]-2,3-dioxopiperazin-1-yl]-6-nitrophenyl] 4,4-dimethylpentanoate |
| SMILES | C=CCN(CC=C)c1ccc(Cl)cc1N1CCN(c2cccc([N+](=O)[O-])c2OC(=O)CCC(C)(C)C)C(=O)C1=O |
| InChI | InChI=1S/C29H33ClN4O6/c1-6-15-31(16-7-2)21-12-11-20(30)19-24(21)33-18-17-32(27(36)28(33)37)22-9-8-10-23(34(38)39)26(22)40-25(35)13-14-29(3,4)5/h6-12,19H,1-2,13-18H2,3-5H3 |
| InChIKey | UEZGREMXZDHITN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|