About CID 175283342
CID 175283342 (PubChem CID 175283342) has the molecular formula C10H13ClSi
and a molecular weight of 196.75 g/mol.
Molecular Properties
| Compound Name | CID 175283342 |
| PubChem CID | 175283342 |
| Molecular Formula | C10H13ClSi |
| Molecular Weight | 196.75 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | — |
| SMILES | CCC(C)[Si]c1ccccc1Cl |
| InChI | InChI=1S/C10H13ClSi/c1-3-8(2)12-10-7-5-4-6-9(10)11/h4-8H,3H2,1-2H3 |
| InChIKey | OBYKZVSMAZAHSP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175283342 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175283342?
The IUPAC name of CID 175283342 (CID 175283342) is not available.
What is the SMILES notation for CID 175283342?
The canonical SMILES for CID 175283342 is CCC(C)[Si]c1ccccc1Cl.
What is the InChIKey of CID 175283342?
The InChIKey is OBYKZVSMAZAHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClSi/c1-3-8(2)12-10-7-5-4-6-9(10)11/h4-8H,3H2,1-2H3.
What are the key properties of CID 175283342?
CID 175283342 has a molecular weight of 196.75 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175283342 is sourced from PubChem (CID 175283342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).