C23H26FN5O3 — CID 175283411
tert-butyl 4-[3-carbamoyl-5-(2-fluoro-4-pyridinyl)indazol-1-yl]piperidine-1-carboxylate (PubChem CID 175283411) has the molecular formula C23H26FN5O3 and a molecular weight of 439.49 g/mol. Its IUPAC name is tert-butyl 4-[3-carbamoyl-5-(2-fluoro-4-pyridinyl)indazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-carbamoyl-5-(2-fluoro-4-pyridinyl)indazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175283411 |
| Molecular Formula | C23H26FN5O3 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | tert-butyl 4-[3-carbamoyl-5-(2-fluoro-4-pyridinyl)indazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2nc(C(N)=O)c3cc(-c4ccnc(F)c4)ccc32)CC1 |
| InChI | InChI=1S/C23H26FN5O3/c1-23(2,3)32-22(31)28-10-7-16(8-11-28)29-18-5-4-14(15-6-9-26-19(24)13-15)12-17(18)20(27-29)21(25)30/h4-6,9,12-13,16H,7-8,10-11H2,1-3H3,(H2,25,30) |
| InChIKey | SDZMXXHWARSCEO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|