C8H4ClF2N5O2 — CID 175284187
(3-amino-6-chloro-5,7-difluoro-1,2,4-benzotriazin-8-yl) carbamate (PubChem CID 175284187) has the molecular formula C8H4ClF2N5O2 and a molecular weight of 275.60 g/mol. Its IUPAC name is (3-amino-6-chloro-5,7-difluoro-1,2,4-benzotriazin-8-yl) carbamate.
| Compound Name | (3-amino-6-chloro-5,7-difluoro-1,2,4-benzotriazin-8-yl) carbamate |
|---|---|
| PubChem CID | 175284187 |
| Molecular Formula | C8H4ClF2N5O2 |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | (3-amino-6-chloro-5,7-difluoro-1,2,4-benzotriazin-8-yl) carbamate |
| SMILES | NC(=O)Oc1c(F)c(Cl)c(F)c2nc(N)nnc12 |
| InChI | InChI=1S/C8H4ClF2N5O2/c9-1-2(10)4-5(15-16-7(12)14-4)6(3(1)11)18-8(13)17/h(H2,13,17)(H2,12,14,16) |
| InChIKey | DWVARVHYLVWLLA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|