About (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate
(3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate (PubChem CID 175534971) has the molecular formula C8H6ClN5O2
and a molecular weight of 239.62 g/mol. Its IUPAC name is (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate.
Molecular Properties
| Compound Name | (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate |
| PubChem CID | 175534971 |
| Molecular Formula | C8H6ClN5O2 |
| Molecular Weight | 239.62 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate |
| SMILES | NC(=O)Oc1cc(Cl)cc2nc(N)nnc12 |
| InChI | InChI=1S/C8H6ClN5O2/c9-3-1-4-6(13-14-7(10)12-4)5(2-3)16-8(11)15/h1-2H,(H2,11,15)(H2,10,12,14) |
| InChIKey | FQNHPVNZBBSEMI-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 117.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.62 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate?
The IUPAC name of (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate (CID 175534971) is (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate.
What is the SMILES notation for (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate?
The canonical SMILES for (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate is NC(=O)Oc1cc(Cl)cc2nc(N)nnc12.
What is the InChIKey of (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate?
The InChIKey is FQNHPVNZBBSEMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN5O2/c9-3-1-4-6(13-14-7(10)12-4)5(2-3)16-8(11)15/h1-2H,(H2,11,15)(H2,10,12,14).
What are the key properties of (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate?
(3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate has a molecular weight of 239.62 g/mol, XLogP of 0.72, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-6-chloro-1,2,4-benzotriazin-8-yl) carbamate is sourced from PubChem (CID 175534971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).