About bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate
bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate (PubChem CID 175285475) has the molecular formula C37H36O4
and a molecular weight of 544.69 g/mol. Its IUPAC name is bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate.
Molecular Properties
| Compound Name | bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate |
| PubChem CID | 175285475 |
| Molecular Formula | C37H36O4 |
| Molecular Weight | 544.69 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate |
| SMILES | O=C(CC(=O)OCCCc1ccc(/C=C/c2ccccc2)cc1)OCCCc1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C37H36O4/c38-36(40-27-7-13-32-17-23-34(24-18-32)21-15-30-9-3-1-4-10-30)29-37(39)41-28-8-14-33-19-25-35(26-20-33)22-16-31-11-5-2-6-12-31/h1-6,9-12,15-26H,7-8,13-14,27-29H2/b21-15+,22-16+ |
| InChIKey | KHEVHZKNXRCLCB-YHARCJFQSA-N |
| XLogP | 8.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate?
The IUPAC name of bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate (CID 175285475) is bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate.
What is the SMILES notation for bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate?
The canonical SMILES for bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate is O=C(CC(=O)OCCCc1ccc(/C=C/c2ccccc2)cc1)OCCCc1ccc(/C=C/c2ccccc2)cc1.
What is the InChIKey of bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate?
The InChIKey is KHEVHZKNXRCLCB-YHARCJFQSA-N. The full InChI is InChI=1S/C37H36O4/c38-36(40-27-7-13-32-17-23-34(24-18-32)21-15-30-9-3-1-4-10-30)29-37(39)41-28-8-14-33-19-25-35(26-20-33)22-16-31-11-5-2-6-12-31/h1-6,9-12,15-26H,7-8,13-14,27-29H2/b21-15+,22-16+.
What are the key properties of bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate?
bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate has a molecular weight of 544.69 g/mol, XLogP of 8.07, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-[4-[(E)-2-phenylethenyl]phenyl]propyl] propanedioate is sourced from PubChem (CID 175285475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).