C11H15NO4 — CID 175286689
(1S,2R,3S,4R)-4-amino-1-(4-hydroxyphenyl)cyclopentane-1,2,3-triol (PubChem CID 175286689) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-amino-1-(4-hydroxyphenyl)cyclopentane-1,2,3-triol.
| Compound Name | (1S,2R,3S,4R)-4-amino-1-(4-hydroxyphenyl)cyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 175286689 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (1S,2R,3S,4R)-4-amino-1-(4-hydroxyphenyl)cyclopentane-1,2,3-triol |
| SMILES | N[C@@H]1C[C@](O)(c2ccc(O)cc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H15NO4/c12-8-5-11(16,10(15)9(8)14)6-1-3-7(13)4-2-6/h1-4,8-10,13-16H,5,12H2/t8-,9+,10-,11+/m1/s1 |
| InChIKey | VQUDOCOSROWGQY-YTWAJWBKSA-N |
| XLogP | -0.97 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |