C9H12N2O3S — CID 175287072
5-(cyclopropylmethoxy)pyridine-3-sulfonamide (PubChem CID 175287072) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is 5-(cyclopropylmethoxy)pyridine-3-sulfonamide.
| Compound Name | 5-(cyclopropylmethoxy)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 175287072 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 5-(cyclopropylmethoxy)pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)c1cncc(OCC2CC2)c1 |
| InChI | InChI=1S/C9H12N2O3S/c10-15(12,13)9-3-8(4-11-5-9)14-6-7-1-2-7/h3-5,7H,1-2,6H2,(H2,10,12,13) |
| InChIKey | DWFQXIINFYZPQK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |