About aniline;cyclopropa[a]indene
aniline;cyclopropa[a]indene (PubChem CID 175287346) has the molecular formula C16H13N
and a molecular weight of 219.29 g/mol. Its IUPAC name is aniline;cyclopropa[a]indene.
Molecular Properties
| Compound Name | aniline;cyclopropa[a]indene |
| PubChem CID | 175287346 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | aniline;cyclopropa[a]indene |
| SMILES | Nc1ccccc1.c1ccc2c3cc-3cc2c1 |
| InChI | InChI=1S/C10H6.C6H7N/c1-2-4-9-7(3-1)5-8-6-10(8)9;7-6-4-2-1-3-5-6/h1-6H;1-5H,7H2 |
| InChIKey | IBMKFXHQKDOGOH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;cyclopropa[a]indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;cyclopropa[a]indene?
The IUPAC name of aniline;cyclopropa[a]indene (CID 175287346) is aniline;cyclopropa[a]indene.
What is the SMILES notation for aniline;cyclopropa[a]indene?
The canonical SMILES for aniline;cyclopropa[a]indene is Nc1ccccc1.c1ccc2c3cc-3cc2c1.
What is the InChIKey of aniline;cyclopropa[a]indene?
The InChIKey is IBMKFXHQKDOGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6.C6H7N/c1-2-4-9-7(3-1)5-8-6-10(8)9;7-6-4-2-1-3-5-6/h1-6H;1-5H,7H2.
What are the key properties of aniline;cyclopropa[a]indene?
aniline;cyclopropa[a]indene has a molecular weight of 219.29 g/mol, XLogP of 4.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;cyclopropa[a]indene is sourced from PubChem (CID 175287346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).