C46H43N3O3 — CID 175287674
1-(2-aminophenyl)ethanone;benzaldehyde;2,4-bis[2-(benzylideneamino)phenyl]pentan-3-one (PubChem CID 175287674) has the molecular formula C46H43N3O3 and a molecular weight of 685.87 g/mol. Its IUPAC name is 1-(2-aminophenyl)ethanone;benzaldehyde;2,4-bis[2-(benzylideneamino)phenyl]pentan-3-one.
| Compound Name | 1-(2-aminophenyl)ethanone;benzaldehyde;2,4-bis[2-(benzylideneamino)phenyl]pentan-3-one |
|---|---|
| PubChem CID | 175287674 |
| Molecular Formula | C46H43N3O3 |
| Molecular Weight | 685.87 g/mol |
| Exact Mass | 685.33 |
| IUPAC Name | 1-(2-aminophenyl)ethanone;benzaldehyde;2,4-bis[2-(benzylideneamino)phenyl]pentan-3-one |
| SMILES | CC(=O)c1ccccc1N.CC(C(=O)C(C)c1ccccc1/N=C/c1ccccc1)c1ccccc1/N=C/c1ccccc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C31H28N2O.C8H9NO.C7H6O/c1-23(27-17-9-11-19-29(27)32-21-25-13-5-3-6-14-25)31(34)24(2)28-18-10-12-20-30(28)33-22-26-15-7-4-8-16-26;1-6(10)7-4-2-3-5-8(7)9;8-6-7-4-2-1-3-5-7/h3-24H,1-2H3;2-5H,9H2,1H3;1-6H/b32-21+,33-22+;; |
| InChIKey | UYMRVUAOBMFSEU-RYKQHHOKSA-N |
| XLogP | 10.63 |
| TPSA | 101.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.87 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|